C18H28N2O5 — CID 66969763
benzyl 4-(2-hydroxyethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 66969763) has the molecular formula C18H28N2O5 and a molecular weight of 352.43 g/mol. Its IUPAC name is benzyl 4-(2-hydroxyethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | benzyl 4-(2-hydroxyethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 66969763 |
| Molecular Formula | C18H28N2O5 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | benzyl 4-(2-hydroxyethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC(C)(C)OC(=O)NC(CCNCCO)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H28N2O5/c1-18(2,3)25-17(23)20-15(9-10-19-11-12-21)16(22)24-13-14-7-5-4-6-8-14/h4-8,15,19,21H,9-13H2,1-3H3,(H,20,23) |
| InChIKey | KVJZGTKXSPSWOX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|