C24H32N4O3 — CID 167940458
tert-butyl N-[[(3R,4R)-1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]-4-phenylpyrrolidin-3-yl]methyl]carbamate (PubChem CID 167940458) has the molecular formula C24H32N4O3 and a molecular weight of 424.55 g/mol. Its IUPAC name is tert-butyl N-[[(3R,4R)-1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]-4-phenylpyrrolidin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(3R,4R)-1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]-4-phenylpyrrolidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 167940458 |
| Molecular Formula | C24H32N4O3 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | tert-butyl N-[[(3R,4R)-1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]-4-phenylpyrrolidin-3-yl]methyl]carbamate |
| SMILES | C#CCCC1(CCC(=O)N2C[C@@H](CNC(=O)OC(C)(C)C)[C@H](c3ccccc3)C2)N=N1 |
| InChI | InChI=1S/C24H32N4O3/c1-5-6-13-24(26-27-24)14-12-21(29)28-16-19(15-25-22(30)31-23(2,3)4)20(17-28)18-10-8-7-9-11-18/h1,7-11,19-20H,6,12-17H2,2-4H3,(H,25,30)/t19-,20+/m1/s1 |
| InChIKey | FLDUXSKTANSINN-UXHICEINSA-N |
| XLogP | 4.11 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|