C26H32N2O3S — CID 175969899
tert-butyl N-[(5S,7R)-3-[(4-thiophen-2-ylbenzoyl)amino]-1-adamantyl]carbamate (PubChem CID 175969899) has the molecular formula C26H32N2O3S and a molecular weight of 452.62 g/mol. Its IUPAC name is tert-butyl N-[(5S,7R)-3-[(4-thiophen-2-ylbenzoyl)amino]-1-adamantyl]carbamate.
| Compound Name | tert-butyl N-[(5S,7R)-3-[(4-thiophen-2-ylbenzoyl)amino]-1-adamantyl]carbamate |
|---|---|
| PubChem CID | 175969899 |
| Molecular Formula | C26H32N2O3S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | tert-butyl N-[(5S,7R)-3-[(4-thiophen-2-ylbenzoyl)amino]-1-adamantyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC12C[C@H]3C[C@@H](C1)CC(NC(=O)c1ccc(-c4cccs4)cc1)(C3)C2 |
| InChI | InChI=1S/C26H32N2O3S/c1-24(2,3)31-23(30)28-26-14-17-11-18(15-26)13-25(12-17,16-26)27-22(29)20-8-6-19(7-9-20)21-5-4-10-32-21/h4-10,17-18H,11-16H2,1-3H3,(H,27,29)(H,28,30)/t17-,18+,25?,26? |
| InChIKey | RVOAFEWTBYCMPL-LJQDGHHOSA-N |
| XLogP | 5.76 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |