C24H26FN2O2P — CID 170245219
4-fluoro-N-[3-[(4-phosphanylbenzoyl)amino]-1-adamantyl]benzamide (PubChem CID 170245219) has the molecular formula C24H26FN2O2P and a molecular weight of 424.46 g/mol. Its IUPAC name is 4-fluoro-N-[3-[(4-phosphanylbenzoyl)amino]-1-adamantyl]benzamide.
| Compound Name | 4-fluoro-N-[3-[(4-phosphanylbenzoyl)amino]-1-adamantyl]benzamide |
|---|---|
| PubChem CID | 170245219 |
| Molecular Formula | C24H26FN2O2P |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 4-fluoro-N-[3-[(4-phosphanylbenzoyl)amino]-1-adamantyl]benzamide |
| SMILES | O=C(NC12CC3CC(C1)CC(NC(=O)c1ccc(P)cc1)(C3)C2)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H26FN2O2P/c25-19-5-1-17(2-6-19)21(28)26-23-10-15-9-16(11-23)13-24(12-15,14-23)27-22(29)18-3-7-20(30)8-4-18/h1-8,15-16H,9-14,30H2,(H,26,28)(H,27,29) |
| InChIKey | YTYLKDVUUNHEKV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|