C26H29FN2O3 — CID 68800861
4-[[[2-(3-fluorophenyl)-2-oxoethyl]amino]methyl]-N-(3-hydroxy-1-adamantyl)benzamide (PubChem CID 68800861) has the molecular formula C26H29FN2O3 and a molecular weight of 436.53 g/mol. Its IUPAC name is 4-[[[2-(3-fluorophenyl)-2-oxoethyl]amino]methyl]-N-(3-hydroxy-1-adamantyl)benzamide.
| Compound Name | 4-[[[2-(3-fluorophenyl)-2-oxoethyl]amino]methyl]-N-(3-hydroxy-1-adamantyl)benzamide |
|---|---|
| PubChem CID | 68800861 |
| Molecular Formula | C26H29FN2O3 |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 4-[[[2-(3-fluorophenyl)-2-oxoethyl]amino]methyl]-N-(3-hydroxy-1-adamantyl)benzamide |
| SMILES | O=C(CNCc1ccc(C(=O)NC23CC4CC(CC(O)(C4)C2)C3)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C26H29FN2O3/c27-22-3-1-2-21(9-22)23(30)15-28-14-17-4-6-20(7-5-17)24(31)29-25-10-18-8-19(11-25)13-26(32,12-18)16-25/h1-7,9,18-19,28,32H,8,10-16H2,(H,29,31) |
| InChIKey | UTBXVFOIINAJRW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |