C12H14FNO — CID 116557703
2-(cyclopropylmethylamino)-1-(3-fluorophenyl)ethanone (PubChem CID 116557703) has the molecular formula C12H14FNO and a molecular weight of 207.25 g/mol. Its IUPAC name is 2-(cyclopropylmethylamino)-1-(3-fluorophenyl)ethanone.
| Compound Name | 2-(cyclopropylmethylamino)-1-(3-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 116557703 |
| Molecular Formula | C12H14FNO |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 2-(cyclopropylmethylamino)-1-(3-fluorophenyl)ethanone |
| SMILES | O=C(CNCC1CC1)c1cccc(F)c1 |
| InChI | InChI=1S/C12H14FNO/c13-11-3-1-2-10(6-11)12(15)8-14-7-9-4-5-9/h1-3,6,9,14H,4-5,7-8H2 |
| InChIKey | DQYXWBOPDAVPKX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |