C12H13F2NO — CID 116557749
2-(cyclopropylmethylamino)-1-(3,5-difluorophenyl)ethanone (PubChem CID 116557749) has the molecular formula C12H13F2NO and a molecular weight of 225.24 g/mol. Its IUPAC name is 2-(cyclopropylmethylamino)-1-(3,5-difluorophenyl)ethanone.
| Compound Name | 2-(cyclopropylmethylamino)-1-(3,5-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 116557749 |
| Molecular Formula | C12H13F2NO |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 2-(cyclopropylmethylamino)-1-(3,5-difluorophenyl)ethanone |
| SMILES | O=C(CNCC1CC1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H13F2NO/c13-10-3-9(4-11(14)5-10)12(16)7-15-6-8-1-2-8/h3-5,8,15H,1-2,6-7H2 |
| InChIKey | CEGGWDVQIUAZQE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |