C16H25N3O4 — CID 98301742
ethyl N-[[(5R,7R)-3-acetamidoadamantane-1-carbonyl]amino]carbamate (PubChem CID 98301742) has the molecular formula C16H25N3O4 and a molecular weight of 323.39 g/mol. Its IUPAC name is ethyl N-[[(5R,7R)-3-acetamidoadamantane-1-carbonyl]amino]carbamate.
| Compound Name | ethyl N-[[(5R,7R)-3-acetamidoadamantane-1-carbonyl]amino]carbamate |
|---|---|
| PubChem CID | 98301742 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | ethyl N-[[(5R,7R)-3-acetamidoadamantane-1-carbonyl]amino]carbamate |
| SMILES | CCOC(=O)NNC(=O)C12C[C@H]3C[C@@H](CC(NC(C)=O)(C3)C1)C2 |
| InChI | InChI=1S/C16H25N3O4/c1-3-23-14(22)19-18-13(21)15-5-11-4-12(6-15)8-16(7-11,9-15)17-10(2)20/h11-12H,3-9H2,1-2H3,(H,17,20)(H,18,21)(H,19,22)/t11-,12-,15?,16?/m1/s1 |
| InChIKey | HSTBMIRIYWBPLY-CPWXYTRJSA-N |
| XLogP | 1.24 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|