About ethyl N-[[(5R,7R)-3-acetamidoadamantane-1-carbonyl]amino]carbamate
ethyl N-[[(5R,7R)-3-acetamidoadamantane-1-carbonyl]amino]carbamate (PubChem CID 98301742) has the molecular formula C16H25N3O4
and a molecular weight of 323.39 g/mol. Its IUPAC name is ethyl N-[[(5R,7R)-3-acetamidoadamantane-1-carbonyl]amino]carbamate.
Molecular Properties
| Compound Name | ethyl N-[[(5R,7R)-3-acetamidoadamantane-1-carbonyl]amino]carbamate |
| PubChem CID | 98301742 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | ethyl N-[[(5R,7R)-3-acetamidoadamantane-1-carbonyl]amino]carbamate |
| SMILES | CCOC(=O)NNC(=O)C12C[C@H]3C[C@@H](CC(NC(C)=O)(C3)C1)C2 |
| InChI | InChI=1S/C16H25N3O4/c1-3-23-14(22)19-18-13(21)15-5-11-4-12(6-15)8-16(7-11,9-15)17-10(2)20/h11-12H,3-9H2,1-2H3,(H,17,20)(H,18,21)(H,19,22)/t11-,12-,15?,16?/m1/s1 |
| InChIKey | HSTBMIRIYWBPLY-CPWXYTRJSA-N |
| XLogP | 1.24 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[[(5R,7R)-3-acetamidoadamantane-1-carbonyl]amino]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[[(5R,7R)-3-acetamidoadamantane-1-carbonyl]amino]carbamate?
The IUPAC name of ethyl N-[[(5R,7R)-3-acetamidoadamantane-1-carbonyl]amino]carbamate (CID 98301742) is ethyl N-[[(5R,7R)-3-acetamidoadamantane-1-carbonyl]amino]carbamate.
What is the SMILES notation for ethyl N-[[(5R,7R)-3-acetamidoadamantane-1-carbonyl]amino]carbamate?
The canonical SMILES for ethyl N-[[(5R,7R)-3-acetamidoadamantane-1-carbonyl]amino]carbamate is CCOC(=O)NNC(=O)C12C[C@H]3C[C@@H](CC(NC(C)=O)(C3)C1)C2.
What is the InChIKey of ethyl N-[[(5R,7R)-3-acetamidoadamantane-1-carbonyl]amino]carbamate?
The InChIKey is HSTBMIRIYWBPLY-CPWXYTRJSA-N. The full InChI is InChI=1S/C16H25N3O4/c1-3-23-14(22)19-18-13(21)15-5-11-4-12(6-15)8-16(7-11,9-15)17-10(2)20/h11-12H,3-9H2,1-2H3,(H,17,20)(H,18,21)(H,19,22)/t11-,12-,15?,16?/m1/s1.
What are the key properties of ethyl N-[[(5R,7R)-3-acetamidoadamantane-1-carbonyl]amino]carbamate?
ethyl N-[[(5R,7R)-3-acetamidoadamantane-1-carbonyl]amino]carbamate has a molecular weight of 323.39 g/mol, XLogP of 1.24, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[[(5R,7R)-3-acetamidoadamantane-1-carbonyl]amino]carbamate is sourced from PubChem (CID 98301742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).