C27H39N3O5 — CID 98393155
(5R,7R)-3-acetamido-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)adamantane-1-carboxamide (PubChem CID 98393155) has the molecular formula C27H39N3O5 and a molecular weight of 485.63 g/mol. Its IUPAC name is (5R,7R)-3-acetamido-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)adamantane-1-carboxamide.
| Compound Name | (5R,7R)-3-acetamido-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 98393155 |
| Molecular Formula | C27H39N3O5 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.29 |
| IUPAC Name | (5R,7R)-3-acetamido-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)adamantane-1-carboxamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)C12C[C@H]3C[C@@H](CC(NC(C)=O)(C3)C1)C2 |
| InChI | InChI=1S/C27H39N3O5/c1-4-34-23-12-22(30-6-8-33-9-7-30)24(35-5-2)11-21(23)28-25(32)26-13-19-10-20(14-26)16-27(15-19,17-26)29-18(3)31/h11-12,19-20H,4-10,13-17H2,1-3H3,(H,28,32)(H,29,31)/t19-,20-,26?,27?/m1/s1 |
| InChIKey | MRIIYRVGDFMLHH-KDGKYOGISA-N |
| XLogP | 3.73 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|