C26H38N2O4 — CID 4877971
2-(1-adamantyl)-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)acetamide (PubChem CID 4877971) has the molecular formula C26H38N2O4 and a molecular weight of 442.60 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-(1-adamantyl)-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 4877971 |
| Molecular Formula | C26H38N2O4 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | 2-(1-adamantyl)-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)acetamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C26H38N2O4/c1-3-31-23-13-22(28-5-7-30-8-6-28)24(32-4-2)12-21(23)27-25(29)17-26-14-18-9-19(15-26)11-20(10-18)16-26/h12-13,18-20H,3-11,14-17H2,1-2H3,(H,27,29) |
| InChIKey | DOIYDADRICFCFL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|