C15H21N3 — CID 59860945
4-(azidomethyl)pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane (PubChem CID 59860945) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 4-(azidomethyl)pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane.
| Compound Name | 4-(azidomethyl)pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane |
|---|---|
| PubChem CID | 59860945 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 4-(azidomethyl)pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane |
| SMILES | [N-]=[N+]=NCC12CC3C4CC5CC3C(C1)C(C5)C4C2 |
| InChI | InChI=1S/C15H21N3/c16-18-17-7-15-4-12-9-1-8-2-10(12)14(6-15)11(3-8)13(9)5-15/h8-14H,1-7H2 |
| InChIKey | GIJCHPHJYVAMQD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|