About 4-(azidomethyl)pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane
4-(azidomethyl)pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane (PubChem CID 59860945) has the molecular formula C15H21N3
and a molecular weight of 243.35 g/mol. Its IUPAC name is 4-(azidomethyl)pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane.
Molecular Properties
| Compound Name | 4-(azidomethyl)pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane |
| PubChem CID | 59860945 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 4-(azidomethyl)pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane |
| SMILES | [N-]=[N+]=NCC12CC3C4CC5CC3C(C1)C(C5)C4C2 |
| InChI | InChI=1S/C15H21N3/c16-18-17-7-15-4-12-9-1-8-2-10(12)14(6-15)11(3-8)13(9)5-15/h8-14H,1-7H2 |
| InChIKey | GIJCHPHJYVAMQD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-(azidomethyl)pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(azidomethyl)pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane?
The IUPAC name of 4-(azidomethyl)pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane (CID 59860945) is 4-(azidomethyl)pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane.
What is the SMILES notation for 4-(azidomethyl)pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane?
The canonical SMILES for 4-(azidomethyl)pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane is [N-]=[N+]=NCC12CC3C4CC5CC3C(C1)C(C5)C4C2.
What is the InChIKey of 4-(azidomethyl)pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane?
The InChIKey is GIJCHPHJYVAMQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3/c16-18-17-7-15-4-12-9-1-8-2-10(12)14(6-15)11(3-8)13(9)5-15/h8-14H,1-7H2.
What are the key properties of 4-(azidomethyl)pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane?
4-(azidomethyl)pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane has a molecular weight of 243.35 g/mol, XLogP of 4.01, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(azidomethyl)pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane is sourced from PubChem (CID 59860945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).