C5H8N3O4P — CID 102119002
4-(azidomethyl)-1-oxido-2,6,7-trioxa-1-phosphoniabicyclo[2.2.2]octane (PubChem CID 102119002) has the molecular formula C5H8N3O4P and a molecular weight of 205.11 g/mol. Its IUPAC name is 4-(azidomethyl)-1-oxido-2,6,7-trioxa-1-phosphoniabicyclo[2.2.2]octane.
| Compound Name | 4-(azidomethyl)-1-oxido-2,6,7-trioxa-1-phosphoniabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 102119002 |
| Molecular Formula | C5H8N3O4P |
| Molecular Weight | 205.11 g/mol |
| Exact Mass | 205.03 |
| IUPAC Name | 4-(azidomethyl)-1-oxido-2,6,7-trioxa-1-phosphoniabicyclo[2.2.2]octane |
| SMILES | [N-]=[N+]=NCC12CO[P+]([O-])(OC1)OC2 |
| InChI | InChI=1S/C5H8N3O4P/c6-8-7-1-5-2-10-13(9,11-3-5)12-4-5/h1-4H2 |
| InChIKey | IHTIIIMVCUHGKK-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 99.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.11 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|