C6H10N6O — CID 141350336
2-(1,3-diazido-2-methylpropan-2-yl)oxirane (PubChem CID 141350336) has the molecular formula C6H10N6O and a molecular weight of 182.19 g/mol. Its IUPAC name is 2-(1,3-diazido-2-methylpropan-2-yl)oxirane.
| Compound Name | 2-(1,3-diazido-2-methylpropan-2-yl)oxirane |
|---|---|
| PubChem CID | 141350336 |
| Molecular Formula | C6H10N6O |
| Molecular Weight | 182.19 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 2-(1,3-diazido-2-methylpropan-2-yl)oxirane |
| SMILES | CC(CN=[N+]=[N-])(CN=[N+]=[N-])C1CO1 |
| InChI | InChI=1S/C6H10N6O/c1-6(3-9-11-7,4-10-12-8)5-2-13-5/h5H,2-4H2,1H3 |
| InChIKey | YXEHLEYWZAPYBS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 110.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.19 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|