C10H19N3 — CID 90130604
1-(3-azido-2,2-dimethylpropyl)-3-methylcyclobutane (PubChem CID 90130604) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is 1-(3-azido-2,2-dimethylpropyl)-3-methylcyclobutane.
| Compound Name | 1-(3-azido-2,2-dimethylpropyl)-3-methylcyclobutane |
|---|---|
| PubChem CID | 90130604 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 1-(3-azido-2,2-dimethylpropyl)-3-methylcyclobutane |
| SMILES | CC1CC(CC(C)(C)CN=[N+]=[N-])C1 |
| InChI | InChI=1S/C10H19N3/c1-8-4-9(5-8)6-10(2,3)7-12-13-11/h8-9H,4-7H2,1-3H3 |
| InChIKey | OUZWZKFYRQUXTF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|