About 1-(3-azido-2,2-dimethylpropyl)-3-methylcyclobutane
1-(3-azido-2,2-dimethylpropyl)-3-methylcyclobutane (PubChem CID 90130604) has the molecular formula C10H19N3
and a molecular weight of 181.28 g/mol. Its IUPAC name is 1-(3-azido-2,2-dimethylpropyl)-3-methylcyclobutane.
Molecular Properties
| Compound Name | 1-(3-azido-2,2-dimethylpropyl)-3-methylcyclobutane |
| PubChem CID | 90130604 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 1-(3-azido-2,2-dimethylpropyl)-3-methylcyclobutane |
| SMILES | CC1CC(CC(C)(C)CN=[N+]=[N-])C1 |
| InChI | InChI=1S/C10H19N3/c1-8-4-9(5-8)6-10(2,3)7-12-13-11/h8-9H,4-7H2,1-3H3 |
| InChIKey | OUZWZKFYRQUXTF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-azido-2,2-dimethylpropyl)-3-methylcyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-azido-2,2-dimethylpropyl)-3-methylcyclobutane?
The IUPAC name of 1-(3-azido-2,2-dimethylpropyl)-3-methylcyclobutane (CID 90130604) is 1-(3-azido-2,2-dimethylpropyl)-3-methylcyclobutane.
What is the SMILES notation for 1-(3-azido-2,2-dimethylpropyl)-3-methylcyclobutane?
The canonical SMILES for 1-(3-azido-2,2-dimethylpropyl)-3-methylcyclobutane is CC1CC(CC(C)(C)CN=[N+]=[N-])C1.
What is the InChIKey of 1-(3-azido-2,2-dimethylpropyl)-3-methylcyclobutane?
The InChIKey is OUZWZKFYRQUXTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3/c1-8-4-9(5-8)6-10(2,3)7-12-13-11/h8-9H,4-7H2,1-3H3.
What are the key properties of 1-(3-azido-2,2-dimethylpropyl)-3-methylcyclobutane?
1-(3-azido-2,2-dimethylpropyl)-3-methylcyclobutane has a molecular weight of 181.28 g/mol, XLogP of 3.76, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-azido-2,2-dimethylpropyl)-3-methylcyclobutane is sourced from PubChem (CID 90130604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).