C10H22N4O — CID 173483389
3-(3-azido-2,2-dimethylpropoxy)-2,2-dimethylpropan-1-amine (PubChem CID 173483389) has the molecular formula C10H22N4O and a molecular weight of 214.31 g/mol. Its IUPAC name is 3-(3-azido-2,2-dimethylpropoxy)-2,2-dimethylpropan-1-amine.
| Compound Name | 3-(3-azido-2,2-dimethylpropoxy)-2,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 173483389 |
| Molecular Formula | C10H22N4O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | 3-(3-azido-2,2-dimethylpropoxy)-2,2-dimethylpropan-1-amine |
| SMILES | CC(C)(CN)COCC(C)(C)CN=[N+]=[N-] |
| InChI | InChI=1S/C10H22N4O/c1-9(2,5-11)7-15-8-10(3,4)6-13-14-12/h5-8,11H2,1-4H3 |
| InChIKey | WVAQDLUHFUAILP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 84.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|