C8H14N4O2 — CID 132547144
3-(azidomethyl)-3,5,5-trimethylmorpholin-2-one (PubChem CID 132547144) has the molecular formula C8H14N4O2 and a molecular weight of 198.23 g/mol. Its IUPAC name is 3-(azidomethyl)-3,5,5-trimethylmorpholin-2-one.
| Compound Name | 3-(azidomethyl)-3,5,5-trimethylmorpholin-2-one |
|---|---|
| PubChem CID | 132547144 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 3-(azidomethyl)-3,5,5-trimethylmorpholin-2-one |
| SMILES | CC1(C)COC(=O)C(C)(CN=[N+]=[N-])N1 |
| InChI | InChI=1S/C8H14N4O2/c1-7(2)5-14-6(13)8(3,11-7)4-10-12-9/h11H,4-5H2,1-3H3 |
| InChIKey | OIJORZJRVUSSQD-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|