About 4-(azidomethyl)oxan-4-ol
4-(azidomethyl)oxan-4-ol (PubChem CID 15313358) has the molecular formula C6H11N3O2
and a molecular weight of 157.17 g/mol. Its IUPAC name is 4-(azidomethyl)oxan-4-ol.
Molecular Properties
| Compound Name | 4-(azidomethyl)oxan-4-ol |
| PubChem CID | 15313358 |
| Molecular Formula | C6H11N3O2 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 4-(azidomethyl)oxan-4-ol |
| SMILES | [N-]=[N+]=NCC1(O)CCOCC1 |
| InChI | InChI=1S/C6H11N3O2/c7-9-8-5-6(10)1-3-11-4-2-6/h10H,1-5H2 |
| InChIKey | MCJMVTOKZADIAN-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 78.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-(azidomethyl)oxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(azidomethyl)oxan-4-ol?
The IUPAC name of 4-(azidomethyl)oxan-4-ol (CID 15313358) is 4-(azidomethyl)oxan-4-ol.
What is the SMILES notation for 4-(azidomethyl)oxan-4-ol?
The canonical SMILES for 4-(azidomethyl)oxan-4-ol is [N-]=[N+]=NCC1(O)CCOCC1.
What is the InChIKey of 4-(azidomethyl)oxan-4-ol?
The InChIKey is MCJMVTOKZADIAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O2/c7-9-8-5-6(10)1-3-11-4-2-6/h10H,1-5H2.
What are the key properties of 4-(azidomethyl)oxan-4-ol?
4-(azidomethyl)oxan-4-ol has a molecular weight of 157.17 g/mol, XLogP of 0.84, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(azidomethyl)oxan-4-ol is sourced from PubChem (CID 15313358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).