C8H13N3O2 — CID 125457120
(3R,5S)-3-(azidomethyl)-2,7-dioxaspiro[4.4]nonane (PubChem CID 125457120) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is (3R,5S)-3-(azidomethyl)-2,7-dioxaspiro[4.4]nonane.
| Compound Name | (3R,5S)-3-(azidomethyl)-2,7-dioxaspiro[4.4]nonane |
|---|---|
| PubChem CID | 125457120 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | (3R,5S)-3-(azidomethyl)-2,7-dioxaspiro[4.4]nonane |
| SMILES | [N-]=[N+]=NC[C@H]1C[C@]2(CCOC2)CO1 |
| InChI | InChI=1S/C8H13N3O2/c9-11-10-4-7-3-8(6-13-7)1-2-12-5-8/h7H,1-6H2/t7-,8+/m1/s1 |
| InChIKey | VXFHMHSFAYAEQT-SFYZADRCSA-N |
| XLogP | 1.49 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|