C9H16N4O — CID 125455222
(3S,5R)-3-(azidomethyl)-2-oxa-9-azaspiro[4.5]decane (PubChem CID 125455222) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is (3S,5R)-3-(azidomethyl)-2-oxa-9-azaspiro[4.5]decane.
| Compound Name | (3S,5R)-3-(azidomethyl)-2-oxa-9-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 125455222 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | (3S,5R)-3-(azidomethyl)-2-oxa-9-azaspiro[4.5]decane |
| SMILES | [N-]=[N+]=NC[C@@H]1C[C@@]2(CCCNC2)CO1 |
| InChI | InChI=1S/C9H16N4O/c10-13-12-5-8-4-9(7-14-8)2-1-3-11-6-9/h8,11H,1-7H2/t8-,9+/m0/s1 |
| InChIKey | BSUNBKCCZWFBAO-DTWKUNHWSA-N |
| XLogP | 1.46 |
| TPSA | 70.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|