C38H46N6 — CID 157276917
1-(1-adamantylmethyl)-4-phenyltriazole;1-(azidomethyl)adamantane;ethynylbenzene (PubChem CID 157276917) has the molecular formula C38H46N6 and a molecular weight of 586.83 g/mol. Its IUPAC name is 1-(1-adamantylmethyl)-4-phenyltriazole;1-(azidomethyl)adamantane;ethynylbenzene.
| Compound Name | 1-(1-adamantylmethyl)-4-phenyltriazole;1-(azidomethyl)adamantane;ethynylbenzene |
|---|---|
| PubChem CID | 157276917 |
| Molecular Formula | C38H46N6 |
| Molecular Weight | 586.83 g/mol |
| Exact Mass | 586.38 |
| IUPAC Name | 1-(1-adamantylmethyl)-4-phenyltriazole;1-(azidomethyl)adamantane;ethynylbenzene |
| SMILES | C#Cc1ccccc1.[N-]=[N+]=NCC12CC3CC(CC(C3)C1)C2.c1ccc(-c2cn(CC34CC5CC(CC(C5)C3)C4)nn2)cc1 |
| InChI | InChI=1S/C19H23N3.C11H17N3.C8H6/c1-2-4-17(5-3-1)18-12-22(21-20-18)13-19-9-14-6-15(10-19)8-16(7-14)11-19;12-14-13-7-11-4-8-1-9(5-11)3-10(2-8)6-11;1-2-8-6-4-3-5-7-8/h1-5,12,14-16H,6-11,13H2;8-10H,1-7H2;1,3-7H |
| InChIKey | AZFGGWAYSBIBAF-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 79.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.83 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|