C10H10IN3 — CID 10859519
[(1R,2R)-2-(azidomethyl)-2-iodocyclopropyl]benzene (PubChem CID 10859519) has the molecular formula C10H10IN3 and a molecular weight of 299.12 g/mol. Its IUPAC name is [(1R,2R)-2-(azidomethyl)-2-iodocyclopropyl]benzene.
| Compound Name | [(1R,2R)-2-(azidomethyl)-2-iodocyclopropyl]benzene |
|---|---|
| PubChem CID | 10859519 |
| Molecular Formula | C10H10IN3 |
| Molecular Weight | 299.12 g/mol |
| Exact Mass | 298.99 |
| IUPAC Name | [(1R,2R)-2-(azidomethyl)-2-iodocyclopropyl]benzene |
| SMILES | [N-]=[N+]=NC[C@@]1(I)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C10H10IN3/c11-10(7-13-14-12)6-9(10)8-4-2-1-3-5-8/h1-5,9H,6-7H2/t9-,10+/m1/s1 |
| InChIKey | HIOMCFNGIXIEEJ-ZJUUUORDSA-N |
| XLogP | 3.66 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.12 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|