About adamantane;but-2-ene;ethane
adamantane;but-2-ene;ethane (PubChem CID 90963608) has the molecular formula C16H30
and a molecular weight of 222.42 g/mol. Its IUPAC name is adamantane;but-2-ene;ethane.
Molecular Properties
| Compound Name | adamantane;but-2-ene;ethane |
| PubChem CID | 90963608 |
| Molecular Formula | C16H30 |
| Molecular Weight | 222.42 g/mol |
| Exact Mass | 222.23 |
| IUPAC Name | adamantane;but-2-ene;ethane |
| SMILES | C1C2CC3CC1CC(C2)C3.CC.CC=CC |
| InChI | InChI=1S/C10H16.C4H8.C2H6/c1-7-2-9-4-8(1)5-10(3-7)6-9;1-3-4-2;1-2/h7-10H,1-6H2;3-4H,1-2H3;1-2H3 |
| InChIKey | NUHQVNQCMPBIRG-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 222.42 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze adamantane;but-2-ene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane;but-2-ene;ethane?
The IUPAC name of adamantane;but-2-ene;ethane (CID 90963608) is adamantane;but-2-ene;ethane.
What is the SMILES notation for adamantane;but-2-ene;ethane?
The canonical SMILES for adamantane;but-2-ene;ethane is C1C2CC3CC1CC(C2)C3.CC.CC=CC.
What is the InChIKey of adamantane;but-2-ene;ethane?
The InChIKey is NUHQVNQCMPBIRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16.C4H8.C2H6/c1-7-2-9-4-8(1)5-10(3-7)6-9;1-3-4-2;1-2/h7-10H,1-6H2;3-4H,1-2H3;1-2H3.
What are the key properties of adamantane;but-2-ene;ethane?
adamantane;but-2-ene;ethane has a molecular weight of 222.42 g/mol, XLogP of 5.44, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane;but-2-ene;ethane is sourced from PubChem (CID 90963608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).