About 3,3-dimethylpentacyclo[7.3.1.14,12.02,7.06,11]tetradecane
3,3-dimethylpentacyclo[7.3.1.14,12.02,7.06,11]tetradecane (PubChem CID 58143174) has the molecular formula C16H24
and a molecular weight of 216.37 g/mol. Its IUPAC name is 3,3-dimethylpentacyclo[7.3.1.14,12.02,7.06,11]tetradecane.
Analyze 3,3-dimethylpentacyclo[7.3.1.14,12.02,7.06,11]tetradecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethylpentacyclo[7.3.1.14,12.02,7.06,11]tetradecane?
The IUPAC name of 3,3-dimethylpentacyclo[7.3.1.14,12.02,7.06,11]tetradecane (CID 58143174) is 3,3-dimethylpentacyclo[7.3.1.14,12.02,7.06,11]tetradecane.
What is the SMILES notation for 3,3-dimethylpentacyclo[7.3.1.14,12.02,7.06,11]tetradecane?
The canonical SMILES for 3,3-dimethylpentacyclo[7.3.1.14,12.02,7.06,11]tetradecane is CC1(C)C2CC3C4CC5CC3C1C(C5)C4C2.
What is the InChIKey of 3,3-dimethylpentacyclo[7.3.1.14,12.02,7.06,11]tetradecane?
The InChIKey is RMEWMOFKMLNGMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24/c1-16(2)9-6-11-10-3-8-4-13(11)15(16)14(5-8)12(10)7-9/h8-15H,3-7H2,1-2H3.
What are the key properties of 3,3-dimethylpentacyclo[7.3.1.14,12.02,7.06,11]tetradecane?
3,3-dimethylpentacyclo[7.3.1.14,12.02,7.06,11]tetradecane has a molecular weight of 216.37 g/mol, XLogP of 3.96, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethylpentacyclo[7.3.1.14,12.02,7.06,11]tetradecane is sourced from PubChem (CID 58143174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).