C13H22 — CID 140700120
2,4,9-trimethyladamantane (PubChem CID 140700120) has the molecular formula C13H22 and a molecular weight of 178.32 g/mol. Its IUPAC name is 2,4,9-trimethyladamantane.
| Compound Name | 2,4,9-trimethyladamantane |
|---|---|
| PubChem CID | 140700120 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | 2,4,9-trimethyladamantane |
| SMILES | CC1C2CC3CC1C(C)C(C3)C2C |
| InChI | InChI=1S/C13H22/c1-7-11-4-10-5-12(7)9(3)13(6-10)8(11)2/h7-13H,4-6H2,1-3H3 |
| InChIKey | SENRZYXNBQEZHK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |