C13H24OSn — CID 13131422
(2R,4S)-4-trimethylstannyladamantan-2-ol (PubChem CID 13131422) has the molecular formula C13H24OSn and a molecular weight of 315.05 g/mol. Its IUPAC name is (2R,4S)-4-trimethylstannyladamantan-2-ol.
| Compound Name | (2R,4S)-4-trimethylstannyladamantan-2-ol |
|---|---|
| PubChem CID | 13131422 |
| Molecular Formula | C13H24OSn |
| Molecular Weight | 315.05 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | (2R,4S)-4-trimethylstannyladamantan-2-ol |
| SMILES | C[Sn](C)(C)[C@H]1C2CC3CC(C2)[C@@H](O)C1C3 |
| InChI | InChI=1S/C10H15O.3CH3.Sn/c11-10-8-2-6-1-7(4-8)5-9(10)3-6;;;;/h2,6-11H,1,3-5H2;3*1H3;/t6?,7?,8?,9?,10-;;;;/m0..../s1 |
| InChIKey | ARYCFOTZPADEAW-QEIQACPYSA-N |
| XLogP | 3.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.05 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |