About adamantane-2,4-diamine
adamantane-2,4-diamine (PubChem CID 12813520) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is adamantane-2,4-diamine.
Molecular Properties
| Compound Name | adamantane-2,4-diamine |
| PubChem CID | 12813520 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | adamantane-2,4-diamine |
| SMILES | NC1C2CC3CC(C2)C(N)C1C3 |
| InChI | InChI=1S/C10H18N2/c11-9-6-1-5-2-7(4-6)10(12)8(9)3-5/h5-10H,1-4,11-12H2 |
| InChIKey | DXSZCEQFHJQDEQ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze adamantane-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane-2,4-diamine?
The IUPAC name of adamantane-2,4-diamine (CID 12813520) is adamantane-2,4-diamine.
What is the SMILES notation for adamantane-2,4-diamine?
The canonical SMILES for adamantane-2,4-diamine is NC1C2CC3CC(C2)C(N)C1C3.
What is the InChIKey of adamantane-2,4-diamine?
The InChIKey is DXSZCEQFHJQDEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2/c11-9-6-1-5-2-7(4-6)10(12)8(9)3-5/h5-10H,1-4,11-12H2.
What are the key properties of adamantane-2,4-diamine?
adamantane-2,4-diamine has a molecular weight of 166.27 g/mol, XLogP of 0.71, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane-2,4-diamine is sourced from PubChem (CID 12813520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).