About trimethyl(3-tricyclo[2.2.1.02,6]heptanyl)stannane
trimethyl(3-tricyclo[2.2.1.02,6]heptanyl)stannane (PubChem CID 12678484) has the molecular formula C10H18Sn
and a molecular weight of 256.96 g/mol. Its IUPAC name is trimethyl(3-tricyclo[2.2.1.02,6]heptanyl)stannane.
Molecular Properties
| Compound Name | trimethyl(3-tricyclo[2.2.1.02,6]heptanyl)stannane |
| PubChem CID | 12678484 |
| Molecular Formula | C10H18Sn |
| Molecular Weight | 256.96 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | trimethyl(3-tricyclo[2.2.1.02,6]heptanyl)stannane |
| SMILES | C[Sn](C)(C)C1C2CC3C(C2)C31 |
| InChI | InChI=1S/C7H9.3CH3.Sn/c1-4-2-6-5(1)7(6)3-4;;;;/h1,4-7H,2-3H2;3*1H3; |
| InChIKey | UEJKCIWKEVXTBK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.96 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze trimethyl(3-tricyclo[2.2.1.02,6]heptanyl)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl(3-tricyclo[2.2.1.02,6]heptanyl)stannane?
The IUPAC name of trimethyl(3-tricyclo[2.2.1.02,6]heptanyl)stannane (CID 12678484) is trimethyl(3-tricyclo[2.2.1.02,6]heptanyl)stannane.
What is the SMILES notation for trimethyl(3-tricyclo[2.2.1.02,6]heptanyl)stannane?
The canonical SMILES for trimethyl(3-tricyclo[2.2.1.02,6]heptanyl)stannane is C[Sn](C)(C)C1C2CC3C(C2)C31.
What is the InChIKey of trimethyl(3-tricyclo[2.2.1.02,6]heptanyl)stannane?
The InChIKey is UEJKCIWKEVXTBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9.3CH3.Sn/c1-4-2-6-5(1)7(6)3-4;;;;/h1,4-7H,2-3H2;3*1H3;.
What are the key properties of trimethyl(3-tricyclo[2.2.1.02,6]heptanyl)stannane?
trimethyl(3-tricyclo[2.2.1.02,6]heptanyl)stannane has a molecular weight of 256.96 g/mol, XLogP of 2.98, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl(3-tricyclo[2.2.1.02,6]heptanyl)stannane is sourced from PubChem (CID 12678484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).