C9H12O7S — CID 86218903
5-sulfobicyclo[2.2.1]heptane-2,3-dicarboxylic acid (PubChem CID 86218903) has the molecular formula C9H12O7S and a molecular weight of 264.25 g/mol. Its IUPAC name is 5-sulfobicyclo[2.2.1]heptane-2,3-dicarboxylic acid.
| Compound Name | 5-sulfobicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 86218903 |
| Molecular Formula | C9H12O7S |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 5-sulfobicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
| SMILES | O=C(O)C1C2CC(C1C(=O)O)C(S(=O)(=O)O)C2 |
| InChI | InChI=1S/C9H12O7S/c10-8(11)6-3-1-4(7(6)9(12)13)5(2-3)17(14,15)16/h3-7H,1-2H2,(H,10,11)(H,12,13)(H,14,15,16) |
| InChIKey | VTKXYSZEARMXQF-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|