C6H10O7S — CID 90132358
(4R)-4-hydroxy-5-sulfooxane-2-carboxylic acid (PubChem CID 90132358) has the molecular formula C6H10O7S and a molecular weight of 226.21 g/mol. Its IUPAC name is (4R)-4-hydroxy-5-sulfooxane-2-carboxylic acid.
| Compound Name | (4R)-4-hydroxy-5-sulfooxane-2-carboxylic acid |
|---|---|
| PubChem CID | 90132358 |
| Molecular Formula | C6H10O7S |
| Molecular Weight | 226.21 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | (4R)-4-hydroxy-5-sulfooxane-2-carboxylic acid |
| SMILES | O=C(O)C1C[C@@H](O)C(S(=O)(=O)O)CO1 |
| InChI | InChI=1S/C6H10O7S/c7-3-1-4(6(8)9)13-2-5(3)14(10,11)12/h3-5,7H,1-2H2,(H,8,9)(H,10,11,12)/t3-,4?,5?/m1/s1 |
| InChIKey | NWQCYKLHQCOTMO-JYMNUSQCSA-N |
| XLogP | -1.52 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.21 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|