C17H28O4 — CID 139878534
2-cyclononylcyclohexane-1,4-dicarboxylic acid (PubChem CID 139878534) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is 2-cyclononylcyclohexane-1,4-dicarboxylic acid.
| Compound Name | 2-cyclononylcyclohexane-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 139878534 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 2-cyclononylcyclohexane-1,4-dicarboxylic acid |
| SMILES | O=C(O)C1CCC(C(=O)O)C(C2CCCCCCCC2)C1 |
| InChI | InChI=1S/C17H28O4/c18-16(19)13-9-10-14(17(20)21)15(11-13)12-7-5-3-1-2-4-6-8-12/h12-15H,1-11H2,(H,18,19)(H,20,21) |
| InChIKey | ZIDAVKKSFIZMEN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |