C11H18MnO2 — CID 70185276
1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylic acid;manganese (PubChem CID 70185276) has the molecular formula C11H18MnO2 and a molecular weight of 237.20 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylic acid;manganese.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylic acid;manganese |
|---|---|
| PubChem CID | 70185276 |
| Molecular Formula | C11H18MnO2 |
| Molecular Weight | 237.20 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carboxylic acid;manganese |
| SMILES | O=C(O)C1CCCC2CCCCC21.[Mn] |
| InChI | InChI=1S/C11H18O2.Mn/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10;/h8-10H,1-7H2,(H,12,13); |
| InChIKey | YSCPLODNEWCZGI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.20 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |