C12H23P — CID 90947058
dimethyl-(2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)phosphane (PubChem CID 90947058) has the molecular formula C12H23P and a molecular weight of 198.29 g/mol. Its IUPAC name is dimethyl-(2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)phosphane.
| Compound Name | dimethyl-(2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)phosphane |
|---|---|
| PubChem CID | 90947058 |
| Molecular Formula | C12H23P |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.15 |
| IUPAC Name | dimethyl-(2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl)phosphane |
| SMILES | CC1CC2CCCCC2C1P(C)C |
| InChI | InChI=1S/C12H23P/c1-9-8-10-6-4-5-7-11(10)12(9)13(2)3/h9-12H,4-8H2,1-3H3 |
| InChIKey | SAEGTIXGWRRQEC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|