C8H13IO2 — CID 11821590
(3R,4R,5R)-5-[(E)-1-iodoprop-1-enyl]-4-methyloxolan-3-ol (PubChem CID 11821590) has the molecular formula C8H13IO2 and a molecular weight of 268.09 g/mol. Its IUPAC name is (3R,4R,5R)-5-[(E)-1-iodoprop-1-enyl]-4-methyloxolan-3-ol.
| Compound Name | (3R,4R,5R)-5-[(E)-1-iodoprop-1-enyl]-4-methyloxolan-3-ol |
|---|---|
| PubChem CID | 11821590 |
| Molecular Formula | C8H13IO2 |
| Molecular Weight | 268.09 g/mol |
| Exact Mass | 268.00 |
| IUPAC Name | (3R,4R,5R)-5-[(E)-1-iodoprop-1-enyl]-4-methyloxolan-3-ol |
| SMILES | C/C=C(/I)[C@@H]1OC[C@H](O)[C@H]1C |
| InChI | InChI=1S/C8H13IO2/c1-3-6(9)8-5(2)7(10)4-11-8/h3,5,7-8,10H,4H2,1-2H3/b6-3+/t5-,7+,8-/m1/s1 |
| InChIKey | KMCPTKIPHFEUNK-AHKFQMMISA-N |
| XLogP | 1.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.09 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|