C9H16O4 — CID 23240872
[(4R,5R)-2-[(E)-but-2-en-2-yl]-5-(hydroxymethyl)-1,3-dioxolan-4-yl]methanol (PubChem CID 23240872) has the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. Its IUPAC name is [(4R,5R)-2-[(E)-but-2-en-2-yl]-5-(hydroxymethyl)-1,3-dioxolan-4-yl]methanol.
| Compound Name | [(4R,5R)-2-[(E)-but-2-en-2-yl]-5-(hydroxymethyl)-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 23240872 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | [(4R,5R)-2-[(E)-but-2-en-2-yl]-5-(hydroxymethyl)-1,3-dioxolan-4-yl]methanol |
| SMILES | C/C=C(\C)C1O[C@H](CO)[C@@H](CO)O1 |
| InChI | InChI=1S/C9H16O4/c1-3-6(2)9-12-7(4-10)8(5-11)13-9/h3,7-11H,4-5H2,1-2H3/b6-3+/t7-,8-/m1/s1 |
| InChIKey | WNUWLVYFOZGHHG-DZPDEKMQSA-N |
| XLogP | 0.05 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|