C4H7ClO2 — CID 55301080
[(2S,3R)-3-(chloromethyl)oxiran-2-yl]methanol (PubChem CID 55301080) has the molecular formula C4H7ClO2 and a molecular weight of 122.55 g/mol. Its IUPAC name is [(2S,3R)-3-(chloromethyl)oxiran-2-yl]methanol.
| Compound Name | [(2S,3R)-3-(chloromethyl)oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 55301080 |
| Molecular Formula | C4H7ClO2 |
| Molecular Weight | 122.55 g/mol |
| Exact Mass | 122.01 |
| IUPAC Name | [(2S,3R)-3-(chloromethyl)oxiran-2-yl]methanol |
| SMILES | OC[C@@H]1O[C@H]1CCl |
| InChI | InChI=1S/C4H7ClO2/c5-1-3-4(2-6)7-3/h3-4,6H,1-2H2/t3-,4-/m0/s1 |
| InChIKey | FHFIGKVCNSGCKY-IMJSIDKUSA-N |
| XLogP | -0.02 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.55 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|