C7H11ClO — CID 10866483
(2S,3R)-2-but-3-enyl-3-(chloromethyl)oxirane (PubChem CID 10866483) has the molecular formula C7H11ClO and a molecular weight of 146.62 g/mol. Its IUPAC name is (2S,3R)-2-but-3-enyl-3-(chloromethyl)oxirane.
| Compound Name | (2S,3R)-2-but-3-enyl-3-(chloromethyl)oxirane |
|---|---|
| PubChem CID | 10866483 |
| Molecular Formula | C7H11ClO |
| Molecular Weight | 146.62 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | (2S,3R)-2-but-3-enyl-3-(chloromethyl)oxirane |
| SMILES | C=CCC[C@@H]1O[C@H]1CCl |
| InChI | InChI=1S/C7H11ClO/c1-2-3-4-6-7(5-8)9-6/h2,6-7H,1,3-5H2/t6-,7-/m0/s1 |
| InChIKey | PAMOARVREQZZPK-BQBZGAKWSA-N |
| XLogP | 1.96 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.62 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|