C9H18O3 — CID 153300794
[5-(2-methylpropyl)-1,4-dioxan-2-yl]methanol (PubChem CID 153300794) has the molecular formula C9H18O3 and a molecular weight of 174.24 g/mol. Its IUPAC name is [5-(2-methylpropyl)-1,4-dioxan-2-yl]methanol.
| Compound Name | [5-(2-methylpropyl)-1,4-dioxan-2-yl]methanol |
|---|---|
| PubChem CID | 153300794 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | [5-(2-methylpropyl)-1,4-dioxan-2-yl]methanol |
| SMILES | CC(C)CC1COC(CO)CO1 |
| InChI | InChI=1S/C9H18O3/c1-7(2)3-8-5-12-9(4-10)6-11-8/h7-10H,3-6H2,1-2H3 |
| InChIKey | YMTIMZGMSFBRKC-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |