About (5-amino-1,4-dioxan-2-yl)methanol
(5-amino-1,4-dioxan-2-yl)methanol (PubChem CID 155158463) has the molecular formula C5H11NO3
and a molecular weight of 133.15 g/mol. Its IUPAC name is (5-amino-1,4-dioxan-2-yl)methanol.
Molecular Properties
| Compound Name | (5-amino-1,4-dioxan-2-yl)methanol |
| PubChem CID | 155158463 |
| Molecular Formula | C5H11NO3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | (5-amino-1,4-dioxan-2-yl)methanol |
| SMILES | NC1COC(CO)CO1 |
| InChI | InChI=1S/C5H11NO3/c6-5-3-8-4(1-7)2-9-5/h4-5,7H,1-3,6H2 |
| InChIKey | SSJSZDRSWNAMHS-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-amino-1,4-dioxan-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-amino-1,4-dioxan-2-yl)methanol?
The IUPAC name of (5-amino-1,4-dioxan-2-yl)methanol (CID 155158463) is (5-amino-1,4-dioxan-2-yl)methanol.
What is the SMILES notation for (5-amino-1,4-dioxan-2-yl)methanol?
The canonical SMILES for (5-amino-1,4-dioxan-2-yl)methanol is NC1COC(CO)CO1.
What is the InChIKey of (5-amino-1,4-dioxan-2-yl)methanol?
The InChIKey is SSJSZDRSWNAMHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO3/c6-5-3-8-4(1-7)2-9-5/h4-5,7H,1-3,6H2.
What are the key properties of (5-amino-1,4-dioxan-2-yl)methanol?
(5-amino-1,4-dioxan-2-yl)methanol has a molecular weight of 133.15 g/mol, XLogP of -1.32, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-amino-1,4-dioxan-2-yl)methanol is sourced from PubChem (CID 155158463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).