C5H11NO3 — CID 155158463
(5-amino-1,4-dioxan-2-yl)methanol (PubChem CID 155158463) has the molecular formula C5H11NO3 and a molecular weight of 133.15 g/mol. Its IUPAC name is (5-amino-1,4-dioxan-2-yl)methanol.
| Compound Name | (5-amino-1,4-dioxan-2-yl)methanol |
|---|---|
| PubChem CID | 155158463 |
| Molecular Formula | C5H11NO3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | (5-amino-1,4-dioxan-2-yl)methanol |
| SMILES | NC1COC(CO)CO1 |
| InChI | InChI=1S/C5H11NO3/c6-5-3-8-4(1-7)2-9-5/h4-5,7H,1-3,6H2 |
| InChIKey | SSJSZDRSWNAMHS-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |