C8H17O6P — CID 118412815
oxiran-2-ylmethyl dihydrogen phosphate;2-propyloxirane (PubChem CID 118412815) has the molecular formula C8H17O6P and a molecular weight of 240.19 g/mol. Its IUPAC name is oxiran-2-ylmethyl dihydrogen phosphate;2-propyloxirane.
| Compound Name | oxiran-2-ylmethyl dihydrogen phosphate;2-propyloxirane |
|---|---|
| PubChem CID | 118412815 |
| Molecular Formula | C8H17O6P |
| Molecular Weight | 240.19 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | oxiran-2-ylmethyl dihydrogen phosphate;2-propyloxirane |
| SMILES | CCCC1CO1.O=P(O)(O)OCC1CO1 |
| InChI | InChI=1S/C5H10O.C3H7O5P/c1-2-3-5-4-6-5;4-9(5,6)8-2-3-1-7-3/h5H,2-4H2,1H3;3H,1-2H2,(H2,4,5,6) |
| InChIKey | PRQRHQOVSQEVDS-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.19 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|