C6H14NO5P — CID 146511222
[(2S,5R)-5-(methylamino)oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 146511222) has the molecular formula C6H14NO5P and a molecular weight of 211.15 g/mol. Its IUPAC name is [(2S,5R)-5-(methylamino)oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2S,5R)-5-(methylamino)oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 146511222 |
| Molecular Formula | C6H14NO5P |
| Molecular Weight | 211.15 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | [(2S,5R)-5-(methylamino)oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | CN[C@H]1CC[C@@H](COP(=O)(O)O)O1 |
| InChI | InChI=1S/C6H14NO5P/c1-7-6-3-2-5(12-6)4-11-13(8,9)10/h5-7H,2-4H2,1H3,(H2,8,9,10)/t5-,6+/m0/s1 |
| InChIKey | GAZQWLQFUTWPJD-NTSWFWBYSA-N |
| XLogP | -0.18 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.15 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|