C6H14O10P3+ — CID 154937620
[hydroxy(phosphonooxy)phosphoryl]oxy-[(5-methyloxolan-2-yl)methoxy]-oxophosphanium (PubChem CID 154937620) has the molecular formula C6H14O10P3+ and a molecular weight of 339.09 g/mol. Its IUPAC name is [hydroxy(phosphonooxy)phosphoryl]oxy-[(5-methyloxolan-2-yl)methoxy]-oxophosphanium.
| Compound Name | [hydroxy(phosphonooxy)phosphoryl]oxy-[(5-methyloxolan-2-yl)methoxy]-oxophosphanium |
|---|---|
| PubChem CID | 154937620 |
| Molecular Formula | C6H14O10P3+ |
| Molecular Weight | 339.09 g/mol |
| Exact Mass | 338.98 |
| IUPAC Name | [hydroxy(phosphonooxy)phosphoryl]oxy-[(5-methyloxolan-2-yl)methoxy]-oxophosphanium |
| SMILES | CC1CCC(CO[P+](=O)OP(=O)(O)OP(=O)(O)O)O1 |
| InChI | InChI=1S/C6H13O10P3/c1-5-2-3-6(14-5)4-13-17(7)15-19(11,12)16-18(8,9)10/h5-6H,2-4H2,1H3,(H2-,8,9,10,11,12)/p+1 |
| InChIKey | AERKYSIORMWBHR-UHFFFAOYSA-O |
| XLogP | 1.45 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.09 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|