H5O12P4+ — CID 173366635
hydroxy-[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxy-oxophosphanium (PubChem CID 173366635) has the molecular formula H5O12P4+ and a molecular weight of 320.92 g/mol. Its IUPAC name is hydroxy-[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxy-oxophosphanium.
| Compound Name | hydroxy-[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxy-oxophosphanium |
|---|---|
| PubChem CID | 173366635 |
| Molecular Formula | H5O12P4+ |
| Molecular Weight | 320.92 g/mol |
| Exact Mass | 320.87 |
| IUPAC Name | hydroxy-[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxy-oxophosphanium |
| SMILES | O=[P+](O)OP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/H4O12P4/c1-13(2)10-15(6,7)12-16(8,9)11-14(3,4)5/h(H4-,1,2,3,4,5,6,7,8,9)/p+1 |
| InChIKey | KRJSMPXUSSLNLS-UHFFFAOYSA-O |
| XLogP | -0.02 |
| TPSA | 197.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.92 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|