C11H22O4 — CID 134464354
2-[1-(2-propoxyethoxy)propan-2-yloxymethyl]oxirane (PubChem CID 134464354) has the molecular formula C11H22O4 and a molecular weight of 218.29 g/mol. Its IUPAC name is 2-[1-(2-propoxyethoxy)propan-2-yloxymethyl]oxirane.
| Compound Name | 2-[1-(2-propoxyethoxy)propan-2-yloxymethyl]oxirane |
|---|---|
| PubChem CID | 134464354 |
| Molecular Formula | C11H22O4 |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 2-[1-(2-propoxyethoxy)propan-2-yloxymethyl]oxirane |
| SMILES | CCCOCCOCC(C)OCC1CO1 |
| InChI | InChI=1S/C11H22O4/c1-3-4-12-5-6-13-7-10(2)14-8-11-9-15-11/h10-11H,3-9H2,1-2H3 |
| InChIKey | NODVINKBMGEQRN-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|