C13H25NO2 — CID 115644999
tert-butyl 3-(2,4-dimethylpyrrolidin-1-yl)propanoate (PubChem CID 115644999) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is tert-butyl 3-(2,4-dimethylpyrrolidin-1-yl)propanoate.
| Compound Name | tert-butyl 3-(2,4-dimethylpyrrolidin-1-yl)propanoate |
|---|---|
| PubChem CID | 115644999 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | tert-butyl 3-(2,4-dimethylpyrrolidin-1-yl)propanoate |
| SMILES | CC1CC(C)N(CCC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C13H25NO2/c1-10-8-11(2)14(9-10)7-6-12(15)16-13(3,4)5/h10-11H,6-9H2,1-5H3 |
| InChIKey | OBGSEFZGHSAASL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |