C21H40N4O4 — CID 143370344
[2-ethyl-2-(3-piperazin-1-ylpropanoyloxymethyl)butyl] 3-piperazin-1-ylpropanoate (PubChem CID 143370344) has the molecular formula C21H40N4O4 and a molecular weight of 412.58 g/mol. Its IUPAC name is [2-ethyl-2-(3-piperazin-1-ylpropanoyloxymethyl)butyl] 3-piperazin-1-ylpropanoate.
| Compound Name | [2-ethyl-2-(3-piperazin-1-ylpropanoyloxymethyl)butyl] 3-piperazin-1-ylpropanoate |
|---|---|
| PubChem CID | 143370344 |
| Molecular Formula | C21H40N4O4 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | [2-ethyl-2-(3-piperazin-1-ylpropanoyloxymethyl)butyl] 3-piperazin-1-ylpropanoate |
| SMILES | CCC(CC)(COC(=O)CCN1CCNCC1)COC(=O)CCN1CCNCC1 |
| InChI | InChI=1S/C21H40N4O4/c1-3-21(4-2,17-28-19(26)5-11-24-13-7-22-8-14-24)18-29-20(27)6-12-25-15-9-23-10-16-25/h22-23H,3-18H2,1-2H3 |
| InChIKey | YMCFFCOCHYDIST-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |