C33H60N6O8 — CID 164829540
6-[3-[4-[3-oxo-3-[1-(3-piperazin-1-ylpropanoyloxy)propan-2-yloxy]propyl]piperazin-1-yl]propanoyloxy]hexyl 3-piperazin-1-ylpropanoate (PubChem CID 164829540) has the molecular formula C33H60N6O8 and a molecular weight of 668.88 g/mol. Its IUPAC name is 6-[3-[4-[3-oxo-3-[1-(3-piperazin-1-ylpropanoyloxy)propan-2-yloxy]propyl]piperazin-1-yl]propanoyloxy]hexyl 3-piperazin-1-ylpropanoate.
| Compound Name | 6-[3-[4-[3-oxo-3-[1-(3-piperazin-1-ylpropanoyloxy)propan-2-yloxy]propyl]piperazin-1-yl]propanoyloxy]hexyl 3-piperazin-1-ylpropanoate |
|---|---|
| PubChem CID | 164829540 |
| Molecular Formula | C33H60N6O8 |
| Molecular Weight | 668.88 g/mol |
| Exact Mass | 668.45 |
| IUPAC Name | 6-[3-[4-[3-oxo-3-[1-(3-piperazin-1-ylpropanoyloxy)propan-2-yloxy]propyl]piperazin-1-yl]propanoyloxy]hexyl 3-piperazin-1-ylpropanoate |
| SMILES | CC(COC(=O)CCN1CCNCC1)OC(=O)CCN1CCN(CCC(=O)OCCCCCCOC(=O)CCN2CCNCC2)CC1 |
| InChI | InChI=1S/C33H60N6O8/c1-29(28-46-32(42)8-15-37-20-12-35-13-21-37)47-33(43)9-17-39-24-22-38(23-25-39)16-7-31(41)45-27-5-3-2-4-26-44-30(40)6-14-36-18-10-34-11-19-36/h29,34-35H,2-28H2,1H3 |
| InChIKey | TZHRMOURZRRGIB-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 142.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.88 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|