C14H29N3O — CID 114536825
7-amino-1-(3,4,5-trimethylpiperazin-1-yl)heptan-1-one (PubChem CID 114536825) has the molecular formula C14H29N3O and a molecular weight of 255.41 g/mol. Its IUPAC name is 7-amino-1-(3,4,5-trimethylpiperazin-1-yl)heptan-1-one.
| Compound Name | 7-amino-1-(3,4,5-trimethylpiperazin-1-yl)heptan-1-one |
|---|---|
| PubChem CID | 114536825 |
| Molecular Formula | C14H29N3O |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.23 |
| IUPAC Name | 7-amino-1-(3,4,5-trimethylpiperazin-1-yl)heptan-1-one |
| SMILES | CC1CN(C(=O)CCCCCCN)CC(C)N1C |
| InChI | InChI=1S/C14H29N3O/c1-12-10-17(11-13(2)16(12)3)14(18)8-6-4-5-7-9-15/h12-13H,4-11,15H2,1-3H3 |
| InChIKey | YXJWMFXTJMSQHB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|