C15H27ClN2O2 — CID 119803619
1-(1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl)-7-aminoheptan-1-one;hydrochloride (PubChem CID 119803619) has the molecular formula C15H27ClN2O2 and a molecular weight of 302.85 g/mol. Its IUPAC name is 1-(1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl)-7-aminoheptan-1-one;hydrochloride.
| Compound Name | 1-(1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl)-7-aminoheptan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119803619 |
| Molecular Formula | C15H27ClN2O2 |
| Molecular Weight | 302.85 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 1-(1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl)-7-aminoheptan-1-one;hydrochloride |
| SMILES | Cl.NCCCCCCC(=O)N1CC2C3CCC(O3)C2C1 |
| InChI | InChI=1S/C15H26N2O2.ClH/c16-8-4-2-1-3-5-15(18)17-9-11-12(10-17)14-7-6-13(11)19-14;/h11-14H,1-10,16H2;1H |
| InChIKey | KQXNXOSTVBZKEV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.85 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|