C12H21ClN2O2 — CID 119803653
1-(1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl)-3-aminobutan-1-one;hydrochloride (PubChem CID 119803653) has the molecular formula C12H21ClN2O2 and a molecular weight of 260.76 g/mol. Its IUPAC name is 1-(1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl)-3-aminobutan-1-one;hydrochloride.
| Compound Name | 1-(1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl)-3-aminobutan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119803653 |
| Molecular Formula | C12H21ClN2O2 |
| Molecular Weight | 260.76 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 1-(1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindol-2-yl)-3-aminobutan-1-one;hydrochloride |
| SMILES | CC(N)CC(=O)N1CC2C3CCC(O3)C2C1.Cl |
| InChI | InChI=1S/C12H20N2O2.ClH/c1-7(13)4-12(15)14-5-8-9(6-14)11-3-2-10(8)16-11;/h7-11H,2-6,13H2,1H3;1H |
| InChIKey | IQXWYDZDPRMGPA-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.76 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |