C11H24N2S — CID 114541048
2-methyl-3-(3,4,5-trimethylpiperazin-1-yl)propane-1-thiol (PubChem CID 114541048) has the molecular formula C11H24N2S and a molecular weight of 216.39 g/mol. Its IUPAC name is 2-methyl-3-(3,4,5-trimethylpiperazin-1-yl)propane-1-thiol.
| Compound Name | 2-methyl-3-(3,4,5-trimethylpiperazin-1-yl)propane-1-thiol |
|---|---|
| PubChem CID | 114541048 |
| Molecular Formula | C11H24N2S |
| Molecular Weight | 216.39 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | 2-methyl-3-(3,4,5-trimethylpiperazin-1-yl)propane-1-thiol |
| SMILES | CC(CS)CN1CC(C)N(C)C(C)C1 |
| InChI | InChI=1S/C11H24N2S/c1-9(8-14)5-13-6-10(2)12(4)11(3)7-13/h9-11,14H,5-8H2,1-4H3 |
| InChIKey | DRFJFRVDTMLYSM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.39 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|